Can someone help me?

Can Someone Help Me?

Answers

Answer 1

Answer:

Second one: (1,2) (2,4) (3,6)

Step-by-step explanation:

y = 2x

2 = 1(2)

4 = 2(2)

6 = 2(3)

Answer 2

Answer:

(1,2),(2,4),(3,6)

Step-by-step explanation:

y = 2x

y = 2(1)

y = 2

y = 2x

y = 2(3)

y = 6

y = 2x

y = 2(2)

y = 4

x axis and y axis of each coordinate match with equation


Related Questions

I need help PLZZZ!!!
Subtract
-5-(-6)=

Answers

Answer:

1 is the answer

Step-by-step explanation:

-5-(-6) = x

-5 + 6 = x

1 = x

Answer:

s1: -5-(-6)

s2: -5 + 6. multiply minus with minus first

s3: +1. simply arthmatic.

The table shows the test scores and the sleep averages of several students. A) Write the least squares regression equation that models the data. Let x = the test score and y = average sleep. B) Use the equation to determine the approximate test score of a student who sleeps an average of 8 hours a night. Show Your Work. ( Will Mark Brainliest but no Links or nonsense answers please). Answer A and Answer B.​

Answers

Answer:

Approximately 92

Step-by-step explanation:

Using technology, the linear regression model obtained by fitting the data points is:

Y = 0.0914X1 - 0.3741

Where x = test score ; y = average sleep

Slope = 0.0914 ; intercept = - 0.3741

The test score of a student that sleeps 8 hours

y = 8

8 = 0.0914X1 - 0.3741

8 + 0.3741 = 0.0914X1

X = 8.3741 / 0.0914

X = 91.62

choose the correct set up to solve for x

Answers

Answer:

I think c

but I am not sure

As an avid golfer, you want to estimate your average score for 18 holes of golf. Suppose you know that the standard deviation of your score is 16.425 strokes and you want to find a sample mean that is within 5.947 strokes of your true average for all rounds of golf with 90% confidence. How many rounds would you need to play to determine this

Answers

Answer:

21

Step-by-step explanation:

Given that

The holes of golf is 18

The standard deviation of the score is 16.425 strokes

The sample mean is 5.947

And, there is 90% confidence

We need to find out the number of rounds

So,

At 90% confidence interval, the critical value is +/- 1.645

Margin of error = 5.947

Z_0.05 × SD/sqrt (n) = 5.947

1.645 × 16.425/sqrt (n) = 5.947

sqrt(n) = 1.645 × 16.425 ÷ 5.947

sqrt(n) = 4.54

= 21

Cube roots of 1 are +1 and -1 (true and false)​

Answers

False cube root of 1 is plus 1 only.

3x+y=15 create a word problem

Answers

Answer:

---

Step-by-step explanation:

3 adults and 1 child go to a park. The admission fee for adults is x, and the fee for children is y. They spent a total of 15 dollars. Solve for x and y.

---

hope it helps

sorry if it doesn't. I'm the person who solves the problems, not creates them

A certain computer microchip cannot be subjected to temperatures below 59° Fahrenheit. What is this in degrees Celsius?

Answers

Answer:

15°C

Step-by-step explanation:

Use the following formula to convert Fahrenheit to Celsius:

[tex]C=\frac{5}{9}(F-32)[/tex]

Substitute the value for the variable and solve for C.

[tex]C=\frac{5}{9}(59-32)\\C=\frac{5}{9}(27)\\C=15[/tex]

Therefore, 59°F is equivalent to 15°C.

can someone help me

Answers

55 x 7 = 385

dadadsdsadssdgregeg

Type the correct answer in each box. Use numerals instead of words. If necessary, use / for the fraction bar(s). Solve the given system of equations 4x+5y=10 -x-8=3y

Answers

Answer:

[tex]4x + 5y = 10 - - - (a) \\ - x - 8 = 3y \\ - x - 3y = 8 \\ x + 3y = - 8 - - - (b) \\ 4 \times (b) - (a) : \\ = > 0x + 7y = - 42 \\ y = - 6 \\ x - 21 = - 8 \\ x = 13 \\ { \boxed{x = 13}} \\ { \boxed{y = - 6}}[/tex]

Answer:(10,-6)

Step-by-step explanation:

https://app.edmentum.com/mimetex/mimetex?\fs3%5Cbegin%7Barray%7D%7BrclC30C30C30C30C30%7D%204x%20%5C%20+%20%5C%205y%20&=&%2010%20%5C%5C%20-4x%20%5C%20-%20%5C%2012y%20&=&%2032%5C%5C%20%5Chline%200%20%5C%20-%20%5C%207y%20&=&%2042%5C%5C%20y%20&=&%20-6%20%5Cend%7Barray%7D

https://app.edmentum.com/mimetex/mimetex?\fs3%5Cbegin%7Barray%7D%7BrclC30C30C30C30C30%7D%204x%5C%20+%20%5C%205y%20&=&10%20%5C%5C%204x%5C%20+%20%5C%205(-6)%20&=&10%20%5C%5C%204x%5C%20-%20%5C%2030%20&=&10%20%5C%5C%204x%20&=&%2040%20%5C%5C%20x%20&=&%2010%20%5Cend%7Barray%7D

The changes to a company's stock prices for five days are $1.25, -$0.75 , $1.25 -$0.75 and -$0.75 what is the mean change of the stock prices show your work (like fully show the steps por favor)

Answers

Answer: $0.05

Step-by-step explanation:

Mean of a given set of numbers simply means that one should find the average of the numbers. Therefore, the mean change of the stock prices will be:

= ($1.25 + -$0.75 + $1.25 + -$0.75 + -$0.75) / 5

= $0.25 / 5

= $0.05

Therefore, the mean change of the stock prices is $0.05.

The sample survey showed that 67% of internet users said the internet has generally strengthened their relationship with family and friends. Develop a 95% confidence interval for the proportion of respondents who say the internet has strengthened their relationship with family and friends. (Round your answers to four decimal places.)

Answers

Answer:

The 95% confidence interval for the proportion of respondents who say the internet has strengthened their relationship with family and friends is [tex](0.67 - 1.96\sqrt{\frac{0.67*0.33}{n}}, 0.67 + 1.96\sqrt{\frac{0.67*0.33}{n}})[/tex], in which n is the size of the sample.

Step-by-step explanation:

In a sample with a number n of people surveyed with a probability of a success of [tex]\pi[/tex], and a confidence level of [tex]1-\alpha[/tex], we have the following confidence interval of proportions.

[tex]\pi \pm z\sqrt{\frac{\pi(1-\pi)}{n}}[/tex]

In which

z is the z-score that has a p-value of [tex]1 - \frac{\alpha}{2}[/tex].

67% of internet users said the internet has generally strengthened their relationship with family and friends.

This means that [tex]\pi = 0.67[/tex]

95% confidence level

So [tex]\alpha = 0.05[/tex], z is the value of Z that has a p-value of [tex]1 - \frac{0.05}{2} = 0.975[/tex], so [tex]Z = 1.96[/tex].

The lower limit of this interval is:

[tex]\pi - z\sqrt{\frac{\pi(1-\pi)}{n}} = 0.67 - 1.96\sqrt{\frac{0.67*0.33}{n}}[/tex]

The upper limit of this interval is:

[tex]\pi + z\sqrt{\frac{\pi(1-\pi)}{n}} = 0.67 + 1.96\sqrt{\frac{0.67*0.33}{n}}[/tex]

The 95% confidence interval for the proportion of respondents who say the internet has strengthened their relationship with family and friends is [tex](0.67 - 1.96\sqrt{\frac{0.67*0.33}{n}}, 0.67 + 1.96\sqrt{\frac{0.67*0.33}{n}})[/tex], in which n is the size of the sample.

Graph: - 4x + 4y > 20 & 4x + 4y < -12
please help !!!!!

Answers

I’m not totally sure about the less and greater signs because I’m not sure you can graph using those signs but either way their are your line equations

Which is equivalent to sqrt x^10
A. X-5
B. X -1/5
C. X sqrt 10
D. X 1/5
E. X^5

Answers

Answer:  E) x^5

[tex]\sqrt{x^{10}} = x^5[/tex]

=====================================================

Explanation:

We simply take half of the exponent 10 to get 5. This applies to square roots only.

So the rule is [tex]\sqrt{a^b} = a^{b/2}[/tex]

A more general rule is

[tex]\sqrt[n]{a^b} = a^{b/n}[/tex]

If n = 2, then we're dealing with square roots like with this problem. In this case, a = x and b = 10.

Answer:

E

[tex] \sqrt{ {x}^{10} } \\ = \sqrt{ ({x}^{5} ) {}^{2} } \\ = {x}^{5} [/tex]

Referring to the picture below, which of these statements are true? Change in elevation from point A to B. The distance traveled from A to B along the straight line path is a state function. The distance traveled on the curved path from A to B is a state function. The change in elevation from point A to B (Δ) is a state function.

Answers

Answer:

Following are the responses to the given points:

Step-by-step explanation:

The State function is indeed a characteristic that does not depend upon on path to that specific significance.

In contrast, two route functions are called call path operations.

Throughout this case, only the state system includes them. Lift changes are dependent on a particular difference between two balancing states (pressure, temperature).

Find the distance from the point (1,4) to the line y = 1/3x - 3.
A) 4 units
B) 20 units
C) 4 units
OD) 20 units

Answers

Answer:

answer

is 6.325.............

Answer:

2√10

Step-by-step explanation:

I also got this question and it says I got it correct with this answer choice

Which angles are supplementary to
∠4? Select all that apply.


∠2 ∠7
∠5 ∠6
∠1

Answers

Answer:                                              

The supplementary angle are:

∠2

∠3

∠6

∠7

                     


Brayden saves $1,500 at a yearly simple interest rate of 2.5%. How many years
does it take for the amount he has saved to be double the original amount.

Answers

Answer:

40 years.

Step-by-step explanation:

The simple interest formula is given by:

[tex]E = P*I*t[/tex]

In which E is the amount of interest earned, P is the principal(the initial amount of money), I is the interest rate(yearly, as a decimal) and t is the time.

Brayden saves $1,500 at a yearly simple interest rate of 2.5%.

This means that [tex]P = 1500, I = 0.025[/tex]

How many years does it take for the amount he has saved to be double the original amount?

This will happen when the earned money is the principal, that is, E = 1500. So

[tex]E = P*I*t[/tex]

[tex]1500 = 1500*(0.025)*t[/tex]

[tex]t = \frac{1}{0.025}[/tex]

[tex]t = 40[/tex]

40 years.

Answer:

Step-by-step explanation:

40 years.

Step-by-step explanation:

The simple interest formula is given by:

In which E is the amount of interest earned, P is the principal(the initial amount of money), I is the interest rate(yearly, as a decimal) and t is the time.

Brayden saves $1,500 at a yearly simple interest rate of 2.5%.

This means that

How many years does it take for the amount he has saved to be double the original amount?

This will happen when the earned money is the principal, that is, E = 1500. So

PLEASE HELP I will give Brainly to whoever answers !!!

Answers

MmmmmmmmmmmmmmmmmmmmmmmmmA

Answer:

c

Step-by-step explanation:

Which ratio is equivalent to 7 : 3?

49:9

12:8

21:7

28:12

Please answer quickly!

Answers

Answer:

28:12

Step-by-step explanation:

28 divided by 4 is 7

12 divided by 4 is 3

PLS HELP
What is the area of the triangle?

Answers

Answer:

B

Step-by-step explanation:

(base x height)/2 = (2.9 x 8.1)/2 = 11.7 cm^2

Answer:

B

Step-by-step explanation:

what are the inputs of the function below

Answers

Please add an attachment/photo.

Answer:

There is no picture.

Imani stopped at the post office to mail
three packages. The weight of each
package is given below. If the heaviest
package is removed, find the total weight of
the remaining two packages.

Answers

Answer:

24 packages

Step-by-step explanation:

10 points! If correct you get brainliest.
Which one's apply?

Answers

Answer:

The answer is C and E

Step-by-step explanation:

What are the algebraic properties of the logarithm function?

Answers

Answer:

344343234

Step-by-step explanation:

What is the distance between the points (10, 2) and (14,5)?

Answers

Answer:

5

Step-by-step explanation:

We will solve using the Pythagorean theorem.

The difference in the x value is 4. The difference in the y value is 3. A nice, easy to remember, right angle triangle has sides of three, four, and a hypotenuse of five.

But we were lucky here that we could do this in our heads and from memory: 3² + 4² = 5²

The general formula would be:

distance² = (∆x)² + (∆y)²

distance = √[ (14-10)² + (5-2)² ]

= √[ 4² + 3² ]

= √[ 16 + 9 ]

= √[ 25 ]

= 5

PLEASE HELP I WILL MARK BEAINLIST

Answers

Answer:

Is it 1,512?

Step-by-step explanation:

Multiply: –c2(3c – 2)

Answers

-c^2(3c - 2) =
-3c^3 + 2c^2

Answer:

answer in picture

Step-by-step explanation:

Carlos is interested in estimating the mean amount of time it takes players to complete a level of the game he's
designing. He recruits 7 players of varying skill levels and ages to play the level until they complete it (he's willing
to treat this as a random sample), and he times how long it takes each of them. They play separately from each
other, so Carlos is also willing to assume independence. Here are the data with summary statistics:
1
2
3
4
5
6
7
Player
Time (minutes)
48
46
40
34
49
40
37
Mean
T = 42 min
Standard deviation
8z = 5.7 min
Assume that all conditions for inference are met for this sample.
Which of the following is a 95% confidence interval for the mean time in minutes) it takes players to complete
this level?
Choose 1 answer:
1914
3 of 4 -

Answers

Answer:

42±5.3

Step-by-step explanation:

pls help with this thxxu :))

The figure below shows a construction of a triangle,based on the steps and lengths shown,which type of triangle is it?

A- Equilateral
B- Isosceles
C- Scalene
D- Obtuse​

Answers

Answer:

Scalene triangle (Option C)

Step-by-step explanation:

In a scalene triangle , all its sides have different lengths.

According to the figure given in question , lengths of all sides differ from each other. So , the triangle in the figure is a scalene triangle.

Explain why sin(A)=sin(D)
I NEED HELP ASAP

Answers

becouse The size does not differ whether it is big or small, the degree remains the same

Other Questions
Which prompt would be best addressed with a chronological structure?A. Research the history and development of aviation. Be sure to include major milestones, from the Wright brothers' first experiments to the current space program.B. How does your life differ from the life of a child in colonial times? How is it the same? Consider education, family, communication, transportation, and technology in your response.C. You've been studying the life of the Underground Railroad leader Harriet Tubman. How would Tubman's life best de depicted - as a book or as a movie? Explain the pros and cons of each, and support your choice with reasons and examples.D. In the American Revolution, the Americans had a smaller army with less training than the British, yet they were able to win the war and create an independent United States. What factors best explain the outcome of the war? 28. The mass of a steel building frame is 5500 kg. What power is used to raise it to a helght of 5.0 m If the work is done in 12.0 seconds?Remember to include your data, equation, and work when solving this problem. Two organisms mate and produce infertile offspring. Which of the following statements best explains why the offspring are unable to reproduce? The parents are of a different species but of the same genus. Find the slope and y-intercept of the line in the graph. Express the answers as simplified fractions, ifnecessaryThe slope is m =The y-intercept is b = stock co uses a job costing system the following debts appeared in stock work in process account for the month of april balance 4300 direct materials 26,4000 rate of 80% direct labor of 2300 what was the amount og direct materials charged to job no 5 My rule is take a number, double it, add 11, and then subtract 8. Write my rule using x and y. Can you simplify my rule? You have heard that a relative of yours is in the hospital for a minor operation. You have decided to write a letter intended to express your concern. You should: Say how bad you feel about it and ask about the patients well beingGive some light-hearted news from homeSuggest a home-coming party and promise a visit.Cover all three points. Write a letter to your relative. You may add further details of your own if you wish. Make sure you use standard English and the letter is cheerful. Which step normally occurs first at the crime scene? A. MeasuringB. SketchingC. PhotographD. Videography What is the Central Idea of this poem? Caged Bird by Maya AngelouThe free bird leapson the back of the windand floats downstreamtill the current endsand dips his wingsin the orange sun raysand dares to claim the sky.But a bird that stalksdown his narrow cagecan seldom see throughhis bars of ragehis wings are clipped andhis feet are tiedso he opens his throat to sing.The caged bird singswith fearful trillof the things unknownbut longed for stilland his tune is heardon the distant hill for the caged birdsings of freedomThe free bird thinks of another breezeand the trade winds soft through the sighing treesand the fat worms waiting on a dawn-bright lawnand he names the sky his own.But a caged bird stands on the grave of dreamshis shadow shouts on a nightmare screamhis wings are clipped and his feet are tiedso he opens his throat to singThe caged bird sings with a fearful trillof things unknownbut longed for stilland his tune is heardon the distant hillfor the caged birdsings of freedom. HELP When dissolved in water, BLANKproduce solutions of ions.1.ions2. electrolytes3. nonpolar compounds4. nonelectrolytes 2) Use the law of sines to find the length of SRsin(A)/a=sin(B)/b=sin(C)/c The author uses all of the following as evidence to support his argument about the impact of smallpox on Native American populations EXCEPT many Native Americans who contracted smallpox died from it Answer A: many Native Americans who contracted smallpox died from it A the English settlers tried to help the Native Americans who were afflicted with smallpox Answer B: the English settlers tried to help the Native Americans who were afflicted with smallpox B the Native Americans feared smallpox more than any other disease Answer C: the Native Americans feared smallpox more than any other disease C smallpox was widespread among Native Americans Answer D: smallpox was widespread among Native Americans D Submit A pathogen that has its own DNA, but relies on other organisms to replicate that DNAfor them, is called what?Fungus ParasiteVirusBacteria Personal responsibility means ____________.A. taking full responsibility for your own actionsB. taking responsibility for the actions of othersC. pushing responsibility for your actions onto friends or family members D. minimizing your responsibility for a particular action. Explain how Judaism developed. Where did it come from? Who were it's founders? What did it have to endure to remain in existence today? The French invested $287 million into the canal, and sold it to the US for how much? Group of answer choices $30 Million $35 Million $40 Million $45 Million prove that; tan20+4sin20= square root of3 Consider the following statements about the effect of different values of a on the function y = ab^x. Which one of the statements, if any, is incorrect? A. Values of a such that |a| > 1 will vertically stretch the graph of y = b^x.B. Values of a such that 0 < |a| < 1 will vertically compress the graph of y = b^x.C. Negative values of a will reflect y = b^x across the y-axis.D. All of the above statements are correct. What is the act of arranging the meal on the individual plate immediately before its serving time? Which type of biomolecule is used as a catalyst in chemical reactions to lower activation energy