find the measure of the exterior angle 1. with one angle is 50 degrees and 28 degrees​

Find The Measure Of The Exterior Angle 1. With One Angle Is 50 Degrees And 28 Degrees

Answers

Answer 1

Answer:

D. 78°

Step-by-step explanation:

50°+28°= 78°

_______


Related Questions

Find the mean of the following data set: 8.9, 7.2, 3.3, 2.5, 9.4, 3.9, 4.5, 5.4, 8.9

Answers

the mean if the following set is 6

I only need help on number six

Answers

Answer:

288 inches = 8 yards

Step-by-step explanation:

Answer:

[tex]6 . \: 8 \: yards \: = \: 288 \: inches[/tex]

[tex]8. \: 18 \: feets \: = \: 216 \: inches[/tex]

[tex]10. \: \frac{1}{3} \: yards \: = 12 \: inches[/tex]

Step-by-step explanation:

6. 1 yard = 36 inches

8 yards = 36 × 8

= 288

8. 1 feet = 12 inches

18 feets = 12 × 18

= 216 inches

10. 1/3 into decimal = 0.33333333333

1/3 yards = 0.33333333333 × 36

= 12 inches

Hope it is helpful....

A physical fitness association is including the mile run in its high school fitness test. The time for this event is known to possess a normal distribution with a mean of seconds and a standard deviation of seconds. Find the probability that a randomly selected high school student can run the mile in less than seconds. Round to four decimal places.

Answers

Answer:

This probability is the p-value of Z given [tex]Z = \frac{X - \mu}{\sigma}[/tex], considering X as less than X seconds, [tex]\mu[/tex] as the mean and [tex]\sigma[/tex] as the standard deviation.

Step-by-step explanation:

Normal Probability Distribution:

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

In this question:

Mean [tex]\mu[/tex], standard deviation [tex]\sigma[/tex].

Find the probability that a randomly selected high school student can run the mile in less than X seconds.

This probability is the p-value of Z given [tex]Z = \frac{X - \mu}{\sigma}[/tex], considering X as less than X seconds, [tex]\mu[/tex] as the mean and [tex]\sigma[/tex] as the standard deviation.

Mr. Reid​'s storage bin is 4 feet​ long, 3 feet​ wide, and 7 feet tall. Can he fit 81 boxes that each has a volume of 1 cubic foot in his bin​? Explain your answer

Answers

Answer:

Mr. Reid will be able to fit 81 boxes that each has a volume of 1 cubic foot in his bin, since it has a capacity of 84 cubic feet.

Step-by-step explanation:

Given that Mr. Reid's storage bin is 4 feet long, 3 feet wide, and 7 feet tall, to determine if he can fit 81 boxes that each has a volume of 1 cubic foot in his bin, the following calculation, knowing that the volume of a rectangular prism arises from multiplying its height by its width and its length:

4 x 3 x 7 = X

12 x 7 = X

84 = X

84 - (81 x 1) = X

84 - 81 = X

3 = X

Therefore, Mr. Reid will be able to fit 81 boxes that each has a volume of 1 cubic foot in his bin, since it has a capacity of 84 cubic feet.

equations equivalent to x/4+1/3=5/6

Answers

If I rewrite this it would be
3x/12+4/12=10/12
3x=6
So your answer would be
2/4+1/3=5/6
Or
1/2+1/3=5/6
X=2

Can someone help me please?

Answers

the answer is 0.62

62/100 = 0.62

Answer:

0.62

Step-by-step explanation:

the 62 is the number you're mainly working with and the 100 represents the place value! so the 100 means you need to place the top number in the hundredths place (0.62)

Hope this helps! Good luck with your math work!

Find the equation (in terms of x ) of the line through the points (-3,4) and (1,-8)

Answers

Answer:

A(-3,4) B(1,-8)

y-y1/x-x1 =y2-y1/x2-x1

y-4/x--3 = -8-4/1--3

y-4/x+3 = -12/1+3

y-4/x+3 =-12/4

y-4/x+3 = -3

y-4 = -3(x+3)

y-4=-3x-9

y+3x +9-4=

y+3x+5=0

Answer:

y = -3x - 5

Step-by-step explanation:

-3, 4 and 1, -8

1 - -3 = 4

-8 - 4 = -12

[tex]\frac{-12}{4}[/tex] = [tex]\frac{-3}{1}[/tex] = -3

gradient/slope = -3

now substituting in the point -3, 4 to find the y intercept:

4= -3 x -3 + c

4 = 9 + c

-5 = c

y intercept = -5

equation is y = -3x - 5

Write the inverse function for the function, ƒ(x) =1/2 x + 4. Then, find the value of ƒ -1(4). Type your answers in the box.

ƒ -1(x) =

ƒ -1(4) =

Answers

Answer:

0

Step-by-step explanation:

Given that f(x) = 1/2x + 4

Let y = f(x)

y = 1/2 x + 4

Replace y with x

x = 1/2 y + 4

Make y the subject of the formula

1/2y = x - 4

y = 2(x-4)

If x = 3

y = 2(4-4)

y = 2(0)

y = 0

Hence ƒ -1(4) is 0

What's the answer to this? I thought it was -138 apparently it's not? :(

Answers

The answer is 78 because if you substitute with the x=3 it changes the outcome of the answer:)

University of Florida researchers in the Department of Materials Science and Engineering have invented a technique that rapidly detects traces of TNT (Today, Spring 2005). The method, which involves shining a laser on a potentially contaminated object, provides instantaneous results and gives no false positives. In this application, a false positive would occur if the laser detected traces of TNT when, in fact, no TNT were actually present on the object. Let A be the event that the laser light detects traces of TNT. Let B be the event that the object contains no traces of TNT. The probability of a false positive is 0.

Required:
Write this probability in terms of A and B using symbols such as U, ∩ and |.

Answers

Answer:

P(A n B) = 0

Step-by-step explanation:

Given

[tex]A \to[/tex] Traces of TNT detected

[tex]B \to[/tex] No traces of TNT

Required

Probability of false positive

From the question, we understand that A and B must occur to get a positive and the result is 0.

The probability of A and B is represented as: P(A n B)

Include the result (0), we get:

P(A n B) = 0

If the pattern shown continues, how many black keys appear on a pipe organ with a total of 120 keys? Suggestion: use equivalent ratios or a rate table to rationalize your answer.
HURRYYYYY I NEEDDD HELP

Answers

in 12 key 5 black keys are appearing so consider x key will appear in 120 keys

120/x = 12/5

solving further,

x= 50

Answer - If the pattern shown continues, 50 black keys appear on a pipe organ with a total of 120 keys!

The price of an item has been reduced by 70% the original price was $20 what is the price of the item now

Answers

Just find 70 % of $20 and that’s the price.

20 x 0.7 = 14
20 - 14 = 6

The price of the item is $6

Find the length of side y.
y=_ft

Answers

Answer:

y = 5.66388 feet, (round that to whatever you need to round to)

Step-by-step explanation:

cos (51) = y/9

cos(51)*9=

y = 5.66388 feet

△JKL has vertices at J(−2, 4), K(1, 6), and L(4, 4). Determine whether △JKL is a right triangle

Answers

Answer:

Not a right triangle

Obtuse isosceles triangle.

Sides: J = 3.606   K = 6   L = 3.606

Step-by-step explanation:

hope helps you

have a nice day

Simplify using order of operations.​

Answers

i believe the answer is 4 correct me if i’m wrong

Answer:

64 ÷ 16 = 4

Step-by-step explanation:

Using PEMDAS, you first do the parenthesis, which equals 64. Then you do the exponents, which 4² equals 16. Then you divide 64 by 16, which equals 4.

Find the volume of the cone. Round your answer to the nearest hundredth.

Answers

Answer:

I believe the answer is 1.36

What is the range of y= sec-'(x)? PreCal, send help please!!

Answers

Given:

The function is:

[tex]y=\sec^{-1}(x)[/tex]

To find:

The range of the given function.

Solution:

We have,

[tex]y=\sec^{-1}(x)[/tex]

The range of secant inverse function is:

[tex]Range=\{y|0\leq y\leq \pi , y\neq \dfrac{\pi}{2}\}[/tex]

The range of the given function in interval notation is:

[tex]Range=\left[0,\dfrac{\pi}{2}\right)\text{ and }\left( \dfrac{\pi}{2}, \pi\right ][/tex]

Therefore, the correct option is C.

In the given figure, which angle is complementary to <4

Answers

Answer: The definition of a complementary angle is "Either of two angles whose sum is 90°." Thus the complementary angle for 4 is angle 5.

P.S. if you feel this answer is satisfactory I would appreciate it if you would mark it brainiest.

Match each tool with how we used it in class

Answers

Answer:

1 - b

2 - a

3 - c

Step-by-step explanation:

1. B
2.a
3.c
Hope this helps

Dan spent 0.125 of his money in snacks, 1/4 on travelling and saved the
rest. If he saved $65, how much money did he have at first?​

Answers

Answer:

89.38

Step-by-step explanation:

65 times 0.125 = 8.125

65 times 0.25 = 16.25

16.25 plus 8.125 plus 65 = 89.38 dollars

Omar, Amare, and Jack paid a total of $68.25 for dinner and tickets to a concert. The concert
tickets cost $9.75 each. If the 3 friends split the dinner bill equally, how much did each friend
spend on dinner?

Answers

Answer:

32.5

Step-by-step explanation:

I I divided ot then added it together

67-2x+89/2+7-8x=0
help me please​

Answers

Answer:

x = 11.85

Step-by-step explanation:

[tex]67 - 2x + \frac{89}{2} + 7 -8x = 0\\\\67 + \frac{89}{2}+7 = 8x + 2x\\\\\frac{134 + 89 +14}{2} = 10x\\\\10x = 118.5\\\\x = 11.85[/tex]

Answer:

[tex]x = 11 \frac{17}{20}[/tex] or [tex]\frac{237}{20}[/tex]

Step-by-step explanation:

Isolate the variable by dividing each side by factors that don't contain the variable.

PLS HELP ASAP!! need the answer

Answers

Answer:

60 degrees

Step-by-step explanation:

The expression 4x* represents 144​

Answers

Answer:

x=36

Step-by-step explanation:

because 4x36=144

Answer:

4x = 144

4 • 36 = 144

The answer to the equation is 36

Hi plz help, if you can ill mark you 5 starz! :)

Answers

Answer:

12 kg, 1200 mm, 1200 ml (twice), 12 m, and 120 mm

Answer:

12,000 is 12

120 is 120

1.2 L is 1200

1200 is 120

0.12 is 12

PLEASE HELP IM BEING TIMED

Answers

Answer:

1

Step-by-step explanation:

Any number to the 0 power is equal to 1.

Hope that this helps!

Answer:

1 is correct

Any number that is raised to the power of 0 is 1, and any number that’s raised to the power of 1 is itself

A survey of 35 people was conducted to compare their self-reported height to their actual height. The difference between reported height and actual height was calculated. You're testing the claim that the mean difference is greater than 0.7. From the sample, the mean difference was 0.95, with a standard deviation of 0.44. Calculate the test statistic, rounded to two decimal places

Answers

Answer:

The test statistic is t = 3.36.

Step-by-step explanation:

You're testing the claim that the mean difference is greater than 0.7.

At the null hypothesis, we test if it is 0.7 or less, that is:

[tex]H_0: \mu \leq 0.7[/tex]

At the alternate hypothesis, we test if it is greater than 0.7, that is:

[tex]H_1: \mu > 0.7[/tex]

The test statistic is:

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

In which X is the sample mean, [tex]\mu[/tex] is the value tested at the null hypothesis, s is the standard deviation and n is the size of the sample.

0.7 is tested at the null hypothesis:

This means that [tex]\mu = 0.7[/tex]

Survey of 35 people. From the sample, the mean difference was 0.95, with a standard deviation of 0.44.

This means that [tex]n = 35, X = 0.95, s = 0.44[/tex]

Calculate the test statistic

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

[tex]t = \frac{0.95 - 0.7}{\frac{0.44}{\sqrt{35}}}[/tex]

[tex]t = 3.36[/tex]

The test statistic is t = 3.36.

What is the vertical shift of this sinusoidal function?
question is in pic pls help asap :)​

Answers

Answer photo math download it

Step-by-step explanation:

has everything

PLEASE HELP



what's x
cos(x+pi)-sin(x-pi)=0

please show work​

Answers

sin(x+pi)=-sin(x)=sin(-x)=cos(pi/2)

cos (x+pi)=-cos(x)

So according to the question:

cos(pi/2 +x)=cos(x)

Using the solution of cos, obtain:

(pi/2) + x = 2pi +- (x)

case#1: (pi/2) + x = 2pi + (x)

But here, the value of x is canceled, just

case#2: (pi/2) + x = 2pi - (x)

answer------------>>>>>>>>> x=pi-pi/4

Q.6.
Lisa wanted to paint her ugly brown flower box
red. Using the given dimensions, how many square
inches will she have to paint? (remove the top
base)

Answers

Answer:

10x22x8

Step-by-step explanation:

1760 is the answer

Other Questions
The function V=25000\left(0.82\right)^tV=25000(0.82) t models the depreciation of the value of a new car that originally cost $\text{25,000}25,000. VV represents the value of the car and tt represents the time in years from the time the car was purchased. What is the value of the car after 6 years? HOW DO I SOLVE THIS???!! 250-300 word essay on This is my journey What College did Barack Obama, our 44th President Attend?? Lyric poetry uses musical language to do what?Select one:a.tell a story about something that happenedb.express thoughts and feelingsc.create the effect of a songd.give the impression of reading rhymed poetry ??anyone wanna help plz give me a answer not a link and ty Find the sum of the three expressions and choose the correct answer.-2u3v + 5uv - 17u3v - 2u2v25u2v2 - uv + 65 u3v + 3 u2v2 + 4 uv + 55 u3v - 3 u2v2 + 4 uv - 5-5 u3v - 3 u2v2 + 4 uv + 7 What are the coordinates of the solution of these two linear equations write a text of 10 lines about How you celebrate your BIRTHDAY. . . un texto de 10 renglones sobre Como celebras tu cumpleaos. Agrega una imagen o dibujo de tu cumpleaos. Find the Volume: 3.2 cm7 cm4.8 cm A recent Algebra 2 quiz had scores that closely followed a normal distribution with amean of 80 and the standard deviation of 10. (Note: there was extra credit on this quiz)O SDJSSOSDesles2502 SD-3503 SDorations B D E F GUsing the given mean and standard deviation, label the normal curve shown above.le DrivepodA=BEDvery EducationE=F= Use the following information to answer the questions below. Skin color in a certain species of fish is inherited via a single gene with four different alleles. One fish of this type has alleles 1 and 3 (S1S3) and its mate has alleles 2 and 4 (S2S4). If each allele confers a unit of color darkness such that S1 has one unit, S2 has two units, and so on, then what proportion of their offspring would be expected to have five units of color PLs pls pls help!!!!!!!!!!!!! Does anybody know the answer to this question Im having lots of problems do you think that a like France every country had to Revolt to get a mug receive explain by giving example If Wolves Entertainment Company is acting in the best interests of stockholders (following the primary goal of the firm), which of the following is the optimal (best) capital structure for the firm?A. Debt = 50%, Equity = 50%, EPS = $3.05, Stock price = $29.90, Cost of Debt = 3.5%.B. Debt = 80%, Equity = 20%, EPS = $3.28, Stock price = $29.70, Cost of Debt = 5.8%.C. Debt = 40%, Equity = 60%, EPS = $2.95, Stock price = $30.50, Cost of Debt = 3.0%.D. Debt = 60%, Equity = 40%, EPS = $3.18, Stock price = $31.20, Cost of Debt = 4.0%.E. Debt = 70%, Equity = 30%, EPS = $3.42, Stock price = $30.40, Cost of Debt = 5.0%. There are 5 blue dogs for every 2 green cats. How many green cats are there for 1 blue dog? Write a descriptive essay about my best subject Hot summers and cold winters, topsoil rich in organic material, annual precipitation of 75 to 125 cm (30-50 in), and many hardwood trees are characteristics of the: Please solve with explanation