R 0, -180(x, y) maps to the same point as R 0, 180(x, y).
O True
O False

Answers

Answer 1

Answer:

True.

Step-by-step explanation:

Whether you do a rotation 180 degrees clockwise( [tex]R__(-180,O)[/tex]), or a rotation 180 degrees counterclockwise ([tex]R__(180,O)[/tex]), the image will always end up in the coordinate diagonal from the pre-image.


Related Questions

A cactus casts a shadow 33 feet long. At the same time of day,Liam,who is 6 feet tall,casts a shadow 9 feet long,as shown. how tall is the cactus

Answers

If x = 2, y = 6, and z = 4, which expression is equivalent to 4? à 54+0-3+2=4. D Xtra 4 ... A tree is 12 feet tall and casts a shadow 9 feet long. A building nearby.

Can I have some days free because I really am struggling with math these days and I have no money
Please
God loves you

Answers

I feel you, I need some free days too
God loves you too babe

Which of the following is an equivalent expression of 14x² +18x + 5?
A 32x³ +5
B 14x²(18x + 5)
C 5(14x² + 18x)
D 18x + 14x² +5

Answers

Answer:  the correct answer is D

Step-by-step explanation:

Patel is solving 8x2 + 16x + 3 = 0. Which steps could he use to solve the quadratic equation? Select three options. (PLEASE HELP!!!)

Answers

Refer to the photo taken. You didn’t proved the options to choose from, but here’s how to solve the equation.

Use the Fundamental Theorem of Calculus to find an expression for the derivative of the given function defined on the given interval, if it exists.
F(x) = â«^x t+1/t-1 dt, [1,5]

Answers

The derivative of the function is not defined overall on the interval [1, 5]

What is the Fundamental Theorem of Calculus?The essential connection between areas under curves and function derivatives is the Fundamental Theorem of Calculus. The first fundamental theorem of calculus's first section asserts that an integral of a function f over an interval with a variable upper bound can be used to derive an antiderivative or indefinite integral of f. This implies that continuous functions have antiderivatives.The second fundamental theorem of calculus, on the other hand, asserts that the integral of a function f over a specified interval equals the change of any antiderivative F between the endpoints of the interval.Here ,

       [tex]F(x)=\int_{a}^{x}\frac{t +1}{t - 1} dt\\\\F^{'}(x) = \frac{x+1}{x-1}[/tex]

The derivative of the function is not defined overall on the interval [1, 5] as x = 1 makes the derivation infinite.

To learn more about calculus, refer:

https://brainly.com/question/11237537

#SPJ4

standard position intersects the unit circle at (√30/7,-√19/7). What is cot(θ)?

Answers

The cotangent of the angle is -√570/30

How to determine the cotangent of the angle?

From the question, we have the following parameters that can be used in our computation:

(√30/7,-√19/7)

This means that

(x, y) = (√30/7,-√19/7)

The cot(θ) is calculated as

cot(θ) = y/x

Substitute the known values in the above equation, so, we have the following representation

cot(θ) = (-√19/7)/(√30/7)

Evaluate

cot(θ) = -√19/√30

Rationalize

cot(θ) = -√570/30

Hence, the value of cot(θ) is -√570/30

Read more about unit circle at

https://brainly.com/question/20691579

#SPJ1

Patty needs 3/4 cup of bananas to make a loaf of banana bread.

Patty has 1 1/3 cups of bananas.

Does Patty have enough bananas to make 2 loaves of banana bread?

Answers

Answer:

She Does NOT

Step-by-step explanation:

3/4 is .75 1 1/3 is 1.33 3/4*2= 1.5 which is more than 1.33

Myra is taking her first hot-air balloon ride! The balloon was at an altitude of 288 meters until an air current caused it to rise another 36 meters.
What is the altitude of the balloon now?

Answers

The altitude of the balloon now is 324 meters

How to determine the altitude of the balloon now?

From the question, we have the following parameters that can be used in our computation:

Initial altitude = 288 meters

Rise = 36 meters

The altitude of the balloon now is calculated as

Current altitude = Initial altitude + Rise in altitude

Substitute the known values in the above equation, so, we have the following representation

Current altitude = 288 + 36

Evaluate the sum

Current altitude = 324

Hence, the current altitude is 324 meters

Read more about addition at

https://brainly.com/question/4721701

#SPJ1

How to graph -1/2x-2/3y=3/4

Answers

Answer:

To graph an equation using the slope and y-intercept, 1) Write the equation in the form y = MX + b to find the slope m and the y-intercept (0, b). 2) Next, plot the y-intercept. 3) From the y-intercept, move up or down and left or right, depending on whether the slope is positive or negative.

Step-by-step explanation:

Jocelyn and her children went into a movie theater and she bought $75.50 worth of candies and pretzels. Each candy costs $4.75 and each pretzel costs $3.50. She bought a total of 18 candies and pretzels altogether. Determine the number of candies and the number of pretzels that Jocelyn bought.

Answers

Jocelyn buys 41 candies and 25 pretzels by solving system equation using elimination method.

What is a linear equation?

The equations with one, zero, or an infinite number of solutions are known as linear equations with two variables. Each of the two variables in these equations has the largest exponent order of 1. A two-variable linear equation has the conventional form axe + by + c = 0, where x and y are the two variables. The answers can also be expressed as ordered pairs, such as (x, y).

Given that the cost of 1 candy is $4.75 and 1 pretzel is $3.50.

Jocelyn buys 18 candies and pretzels altogether with cost $75.50.

Assume that she buys x candies and y pretzels

Therefore,

x + y = 18  ......(i)

The cost of x candies and y pretzels is 4.75x + 3.50y.

4.75x + 3.50y = 75.50  .....(ii)

Solving equation (i) and (ii) by using elimination method.

Multiply equation (i) by 4.75

4.75x + 4.75y = 85.5 ....(iii)

Subtract equation (ii) from (iii)

4.75x + 4.75y = 85.5

4.75x + 3.50y = 75.50

(-)      (-)             (-)

________________

             1.25 y = 10

                    y  = 8

Putting y = 8 in equation (i)

x + 8 = 18

x = 10

To learn more about system of equations, click on below link:

brainly.com/question/14694091

#SPJ1

A taxi service charges $1.50 plus $0.60 per mile for a trip to the airport. The total charge is $13.50. Determine how many miles it is to the airport.

Answers

Using the linear function y = 0.6x + 1.5, he drove 20 miles to be charged $13.50

Linear Function

The parent linear function is f(x) = x, which is a line passing through the origin. In general, a linear function equation is f(x) = mx + c

where m is the slope of the equation and c is the y - intercept.

To solve this problem, we have to write an equation that models y = mx + c

c = constant = service charge = 1.50m = slope = 0.60

The linear function to model this is given as;

y = 0.6x + 1.5

Assuming a trip cost 13.50, the number of miles can be calculated as;

13.50 = 0.6x + 1.5

0.6x = 13.50 - 1.5

0.6x = 12

x = 12/0.6

x = 20

The drove 20 miles

Learn more on linear function here;

https://brainly.com/question/15602982

#SPJ1

A pilot flies in a straight path for 130​ minutes. She then makes a course correction, heading 10°​ to the right of her original course, and flies 145minutes in the new direction. If she maintains a constant speed of 600 miles per hour, how far is she from her starting position? Round your answer to the nearest mile. Enter deg​​ after any degree value.

Answers

By using properties of triangle, it can be calculated that-

The pilot is 2740 miles from her starting position.

What is a triangle?

A triangle is a three sided two dimensional figure. A triangle has three sides and three interior angles.

Here,

The diagram has been attached

Time = 130 minutes = 2 hrs 10 minutes = [tex]2 + \frac{10}{60}[/tex] hours = [tex]\frac{13}{6}[/tex] hours

Speed = 600 miles per hour

Distance = [tex]\frac{13}{6} \times 600[/tex] = 1300 miles

Now,

Time = 145 minutes = 2 hrs 25 minutes = [tex]2 + \frac{25}{60}[/tex] hours = [tex]\frac{29}{12}[/tex] hours

Distance = [tex]\frac{29}{12}\times 600[/tex] = 1450 miles

Angle = [tex]10^{\circ}[/tex]

[tex]c^2 = 1300^2 + 1450^2 - 2\times 1300\times 1450\times cos(180-10)\\c^2 = 1690000 + 2102500 - (-3712725.2)\\c^2= 7505225.2\\c= \sqrt{7505225.2}\\c = 2740[/tex]

The pilot is 2740 miles from her starting position.

To learn more about triangle, refer to the link-

https://brainly.com/question/17335144

#SPJ1

1/4 + 29/16 - 9735/12

Answers

Answer:

Step-by-step explanation:

To solve this problem, we need to add and subtract the fractions given. To do this, we need to find a common denominator for all of the fractions.

The least common multiple of 4, 16, and 12 is 48, so we can rewrite each fraction with a denominator of 48:

1/4 = 3/12

29/16 = 87/48

9735/12 = 4047/48

Then, we can add and subtract the fractions as follows:

3/12 + 87/48 - 4047/48 = (3 - 4047)/48 = -4044/48 = -84/16

Therefore, the final answer is -84/16, or -5 and 1/16 in simplified form.

Help please fast!! picture attached below 27 point

What is the mean number of points scored by these players?

A. 7
B. 8
C. 9
D. 10

Answers

Option (b) is correct as mean of top five scorers on soccer team is 8 from given bar graph.

What is mean in statistics?

In statistics, in addition to the mode and median, the mean is one of the measures of central tendency. Simply put, the mean is the average of the values in the given set. It indicates that values in a particular data set are distributed equally. The three most frequently employed measures of central tendency are the mean, median, and mode. The total values provided in a datasheet must be added, and the sum must be divided by the total number of values in order to determine the mean. When all of the values are organized in ascending order, the Median is the median value of the given data. While the number in the list that is repeated a maximum of times is the mode.

Mean = (Sum of values)/(Total observations)

Using above formula, we get

Calculating mean for given bar graph,

[tex]=\frac{4+6+10+9+11}{5}\\=\frac{40}{5}\\=8[/tex]

So, mean score of five players comes out to be 8.

Learn more about mean here:

https://brainly.com/question/14532771

#SPJ1

Solve the following
6 2/5 - 4 4/5

Answers

[tex]6\frac{2}{5} - 4\frac{4}{5}[/tex]  can be solved using subtraction of simple fraction and the final result is 8/5 .

what are simple fraction ?

A fraction in which both the numerator and the denominator consist of whole numbers.

Simplest form of a fraction:

A fraction is said to be in its simplest form if 1 is the only common factor of its numerator and denominator. For example, 8/9 ,because 1 is the only common factor of 8 and 9 in this fraction.

Simplifying proper and improper fraction

Find the highest common factor (HCF) of the numerator and  denominator.Divide both the numerator and denominator by HCF.

We simplify fractions because it is always to work or calculate when the fractions are in the simplest form.

To solve :  [tex]6\frac{2}{5} - 4\frac{4}{5}[/tex]

We know that , in simple fraction  [tex]6\frac{2}{5} - 4\frac{4}{5}[/tex] can be written as ,

[tex]6\frac{2}{5} - 4\frac{4}{5} = \frac{32}{5} - \frac{24}{5} = \frac{8}{5}[/tex]

Hence , 8/5 is the final answer .

Learn more about Simple Fractions at:

https://brainly.com/question/28336721

#SPJ1

y=x² - 4x³
Find the value of y when x = -1.

Answers

Answer:

y = 5

Step-by-step explanation:

[tex]y=x^2-4x^3[/tex] (Given)

Plug x = -1 in the above equation, we find:

[tex]y=(-1)^2-4(-1)^3[/tex]

[tex]\rightarrow y=1-4(-1)[/tex]

[tex]\rightarrow y=1+4[/tex]

[tex]\rightarrow \red{y=5}[/tex]

If five standard (six-sided) dice are tossed onto the table, what is the probability that

a. all of them will show an odd number on top?

b. no aces or deuces (that means ones or twos) will show on top?

C. the five dice will show five different values on top?

If Five standard (six-sided) dice are rolled, one at a time. What is the probability that
a. the first two dice show aces, and the next three do not?
b. two of the five dice show aces, and the other three do not?

Answers

The probability of getting a specific number on the first roll of the die is 1/6. The probability of getting that same number on five successive rolls is (1/6)^5 = 1/7776. Because there are six different ways to get the same number on five rolls, multiply by 6 to get the probability of the same number on five successive rolls to be 6/7776 =1/1296.

Determining the probability that all five rolls will be different starts with asking how many ways can you choose 5 numbers from six with replacement and without repetition where order does not matter, then dividing that number by the total number of outcomes in five rolls of the die.

The total number of possible rolls is easy. There are six possible outcomes for each of the five rolls, so the total number of possible combinations after 5 rolls is 6^5 = 7776.

Now if each roll has to be a different number, consider that there are six acceptable outcomes on the first roll of the die. There are only five acceptable outcomes on the second roll, four on the third, three on the fourth, and two on the fifth. Multiplying all these together gives 6x5x4x3x2 = 6! = 720 ways to get a different number on five successive rolls of the die. This probability is 720/7776 ( 0.0926 or 9.26% or 120 times greater than getting the same number on each of five rolls.

Consider a game in which six true dice are rolled. What is the probability of obtaining exactly one ace, at least one ace and exactly two aces?

Exactly 1 ace(one) =6C1 * 5^5 = 18750 / 6^6 = 0.401877572

At Least 1 ace(one) =6C1 *5^5 +6C2 * 5^4 + 6C3 * 5^3......6C6 * 5^0= 31031/6^6 = 0.6651020233

Exactly 2 aces(ones) =6C2 * 5^4 = 9375 / 6^6 = 0.200938786

If you require two specific times(e.g. first time and second time) to be 5(probability 1/6), others to be non-5(probability 1−1/6=5/6). The probabiliy is (1/6)2(5/6)3, you have C52=10 different ways to roll two 5. Therefore the answer is 10(1/6)2(5/6)3, which is approximately 0.1608.

To learn more about five standard (six-sided) dice visit:

https://brainly.com/question/27994198?

#SPJ1

This graph best represents the motion of an object that

a
is increasing its' acceleration.
b
first increases acceleration then remains constant.
c
shows no motion.
d
was at rest and is accelerating uniformly.

Answers

The motion of the object on the graph, can best be represented as an object that d. was at rest and is accelerating uniformly.

What is the acceleration ?

The object on the graph is accelerating such that the acceleration is stable and uniform. This is why the speed - time line is a straight and diagonal line to show that the speed is proportional to time.

We know that the object started from rest because at the point where time was 0, the object was not accelerating and so was not moving. As time moves on, the object increases speed, thereby accelerating.

Find out more on acceleration at https://brainly.com/question/24606066

#SPJ1

The concentration C(t) of a certain drug in the bloodstream after t minutes is given by the formula C(t)=0.05(1−e^−0.2t). What is the concentration after 12 minutes? Round to three decimal places.

Answers

Thus after 12 minutes concentration of drug is 0.045.

The concentration C(t) of a certain drug in the bloodstream after t minutes is given by the formula [tex]c(t) = 0.05(1-e^{-0.2t} )[/tex]

Drug concentration is amongst the most important determinants of clinical response to a drug.

Drug concentration will be seen to increase in biological samples drawn from the systemic circulation when the amount of drug absorbed exceeds the amount of drug that is distributed into the extravascular tissues and the drug that is metabolized and/or excreted during this period.

Thus after 12 minutes concentration of the drug is = C(5).

Now

C(5) = [tex]0.05(1-e^{-0.2t} )[/tex]

= [tex]0.05(1-e^{-2.4} )[/tex]

= 0.05(1-0.0907)

= 0.05×0.9093

= 0.045

The drug concentration is 0.045.

For such more questions about concentration:

https://brainly.com/question/14378082

#SPJ4

It is given that Cos(A) = 1/4 and Sin(B) = 1/2
Where A is in the 3rd quadrant and B is in the 2nd quadrant

a) Find value of Sin(A)
b) Find Value of Cos(A)
c) Find value of cos(A + B) and cos (A - B)
d) Find Value of Sin(A + B) and sin (A - B)
e) What is the quadrant of A + B and A - B
f) Find the value of Sin(2A + 2B)

Answers

The answers for the following trigonometric functions are:

a) Sin(A)=√15/4

b) Cos(A)=1/4

c) Cos(A+B)=(√3-√15)/8

Cos (A- B)=(√3+15)/8

d) Sin(A+ B) =(3√5+1)/8

Sin (A- B)==(3√5-1)/8

e) The quadrant of A+B and A-B is 4th quadrant

f)  Sin(2A + 2B)= (√15-6√5+4√3)/8

What are trigonometric functions?

The trigonometric functions in mathematics are real functions that link the angle of a right-angled triangle to the ratios of two side lengths. They are also known as circular functions, angle functions, or goniometric functions. They are widely employed in all fields of geometry-related study, including geodesy, solid mechanics, celestial mechanics, and many more. Because they are some of the most basic periodic functions, Fourier analysis is frequently employed to examine periodic events.

The sine, cosine, and tangent are the trigonometric functions that are most frequently utilized in contemporary mathematics.

Given,

Cos(A) = 1/4 and Sin(B) = 1/2

4=√1+x²

1+x²=16

x²=15

x=√15

4=1+x²

x²=3

x=√3

a) Sin(A)=√15/4

Sin(B)=1/2

b) Cos(A)=1/4

Cos(B)=√3/2

c) Cos(A+B)=CosACosB-SinASinB

=(1/4)(1/2)-(√15/4)(1/2)

=(√3-√15)/8

Cos(A-B)=CosACosB+SinASinB

=(1/4)(√3/2)+(√15/4)(1/2)

=(√3+15)/8

d) Sin(A+B)+SinACosB+CosASinB

=(√15/4)(√3/2)+(1/4)(1/2)

=(3√5+1)/8

Sin(A-B)=SinACosB-SinBCosA

=(√15/4)(√3/2)-(1/4)(1/2)

=(3√5-1)/8

e) The quadrant of A+B and A -B is 4th quadrant.

f) Sin(2A+2B)=Sin2ACos2B+Cos2ASin2B

=(√15/8)(1-√3)+((4-√15)/4)(√3/2)

=(√15-3√5+4√3-3√5)/8

=(√15-6√5+4√3)/8

To know more about trigonometric functions, visit:

https://brainly.com/question/14746686

#SPJ1

solve for x using cross multiplication x+2/4=x+5/5

Answers

Answer:

There are no solutions

Step-by-step explanation:

x + 2/4 = x + 5/5

x + 1/2 = x + 1

1/2 = 1 or 0.5 = 1

or

x + 2/4 = x + 5/5

x + 1/2 = x + 1

0 = 1/2 or 0 = 0.5

Simon drove 55 miles per hour for 4 hours then 65 miles per hour for 3 hours how far did Simon drive in all

Answers

Answer:

415 miles

Step-by-step explanation:

Start with the speed equation:

speed = distance/time

Now solve the speed equation for distance:

distance = speed × time

Apply the speed equation solved for distance to the two parts of the trip.

4 hours at 55 mph:

distance = 55 mph × 4 hours = 220 miles

3 hours at 65 mph:

distance = 65 mph × 3 hours = 195 miles

Add the two distances to find the total distance:

total distance = 220 miles + 195 miles = 415 miles

Answer: 415 miles

Answer:

415 miles

Step-by-step explanation:

Simon drove 55 miles per hour for 4 hours then 65 miles per hour for 3 hours.

How far did he drive?

d=rt

For the first part of the trip:

d = 55 * 4 = 220 miles

For the second part of the trip:

d = 65*3 =195 miles

Add the miles together

220+195 = 415 miles

Simplify all questions
√(3-√15)²-√(3+√15)²
3√c² if c≥0
√(x²+1)²=5
-5√y² if y>0
0.5√16a² if a<0

Answers

The given equations can be simplified as :

a. -2.√15

b.  c ≥ 0

c.   x = ±2√6

d.   y < 0

e.   a > 0

How to solve inequalities ?

When solving an inequality:

you can add the same quantity to each side you can subtract the same quantity from each side you can multiply or divide each side by the same positive quantity If you multiply or divide each side by a negative quantity, the inequality symbol must be reversed.

a.

Given : √(3-√15)²-√(3+√15)²

   √(3-√15)²-√(3+√15)² = (3-√15)-(3+√15)

   √(3-√15)²-√(3+√15)² = 0 -2√15

   √(3-√15)²-√(3+√15)² = -2.√15

b .  

Given : 3√c² if c≥0

     3√c² if c≥0

    c ≥ 0

c.

Given: √(x²+1)²=5

     √(x²+1)²=5

      on Squaring both sides , we get

      (x²+1) = 25

      x²  = 24

      x = ±2√6

d.

Given : -5√y² if y>0

      -5√y² if y>0

       y < 0 [since , -5 < 0]

e.  

Given : 0.5√16a² if a<0

     0.5√16a² if a<0

      a > 0

Learn more inequalities at :

https://brainly.com/question/24372553

#SPJ1

One person from those who responded will be selected at random. Which of the following is closest to the probability that the person selected will be someone who responded no, given that the person selected is age 55 or older?
a. 0.350
b. 0.427
c. 0.462
d. 0.757
e. 0.818

Answers

Given that they are age 55 or older, it is discovered that there is a (E) 0.8181 = 81.81% probability that the person said no.

What is the probability?

Simply put, probability refers to the likelihood that something will occur.

If we don't know how an event will turn out, one can discuss the probability or likelihood of several events.

Statistics is the study of occurrences that match a probability distribution.

So, as 36 out of 44 adults aged 55 or older chose not to answer the question, the probability is given by:

p = 36/44 = 0.8181

Therefore, given that they are age 55 or older, it is discovered that there is a (E) 0.8181 = 81.81% probability that the person said no.

Know more about probability here:

https://brainly.com/question/28924396

#SPJ4

Find the GCF of each expression.
The GCF of 12y - 3 is_____.
The GFC of 4y + 10 is_____.
The GCF of 28 − 8 is _____.
The GCF of 30 + 18 is _____.

Answers

The  GCF of each expression that was given above are: 3, 2 , 4 , and 6 which can be written as:

12y-3=34y+10=228y-8=430y+18=6

What is greatest common factor?

The GCF which isthe “greatest common factor”.  can be  defined as the largest number that is a factor of two or more numbers.

Intance of this is that the GCF of 24 and 36 is 12, and this is due to the fact that the largest factor that is shared by 24 and 36 is 12.

Option 1:

The GCF of 12y-3=3 because the common factor which is the highest factor of 12 and 3 is 3

Option2

The GCF of 4y+10=2  because the common factor which is the highest factor of 4 and 10 is 2 and so on.

Option 3:

The GCF of 28 − 8= 4 because the common factor which is the highest factor of 28 and 8 is 4

Option 4:

The GCF of 30y+18=6 because the common factor which is the highest factor of 30 and 18 is 6

Learn more about GCF at:

https://brainly.com/question/219464

#SPJ1

Part A: In two or more sentences, explain what a variable expense is and provide at least two examples.

Part B: In two or more sentences, explain what a fixed expense is and provide at least two examples.

Answers

An essential part of a business' operations is its fixed and variable expenses.

What is fixed expense?

It is an expenditure that does not fluctuate, or rather, does not alter over time.

An illustration of a fixed expense is:

1. Mortgage,

2. Rent payments,

3. Utility bills etc

Let see about Variable expense:

It is a cost that typically varies based on how the business uses the goods or services.

Examples of variable costs are as follows:

1. Sales commissions

2. Direct labor costs

3. Cost of raw materials etc

To know more about fixed expense:

https://brainly.com/question/18520563

#SPJ1

help pls will give branliiest if you explain

Answers

Answer:

slope = - 2

Step-by-step explanation:

calculate the slope m using the slope formula

m = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1} }[/tex]

with (x₁, y₁ ) = (11, - 17) and (x₂, y₂ ) = (2, 1) ← 2 ordered pairs from the table

m = [tex]\frac{1-(-17)}{2-11}[/tex] = [tex]\frac{1+17}{-9}[/tex] = [tex]\frac{18}{-9}[/tex] = - 2

for School: Practice & Problem Solving
Amelia needs to buy some cat food. At the nearest store, 3 bags of cat food cost $6.75. How much would Amelia spend on 2 bags of cat food?

Answers

Answer:

$4.50

Step-by-step explanation:

Use a proportion:

$6.75 is to 3 bags as x is to 2 bags.

6.75/3 = x/2

3x = 2 × 6.75

x = 4.50

Answer: $4.50

Answer:

  $4.50

Step-by-step explanation:

Given 3 bags of cat food cost $6.75, you want the cost of 2 bags.

Proportion

Unless there is a volume discount (or surcharge), the price is proportional to the quantity. That means 2 bags will cost 2/3 the amount that 3 bags cost.

  cost of 2 bags = 2/3 · $6.75 = $4.50

Amelia would spend $4.50 on 2 bags of cat food.

CAN SOMEONE HELP WITH THIS QUESTION?✨

Answers

Answer:

351.5625

1,440,000

Step-by-step explanation:

[tex]\boxed{\begin{minipage}{7 cm}\underline{General form of an Exponential Function}\\\\$y=Ae^{kt}$\\\\where:\\\phantom{ww}$\bullet$ $A$ is the initial value ($y$-intercept). \\ \phantom{ww}$\bullet$ $k$ is a constant.\\ \phantom{ww}$\bullet$ $t$ is time.\\\end{minipage}}[/tex]

Given:

Doubling period = 15 minutesAt t = 120 minutes, y = 90,000

(Let t = time in minutes).

If the doubling period is 15 minutes, then at t = 135 minutes, y = 180,000:

[tex]\implies 90000=Ae^{120k}[/tex]

[tex]\implies 180000=Ae^{135k}[/tex]

Divide the second equation by the first to eliminate A, and solve for k:

[tex]\implies \dfrac{180000}{90000}=\dfrac{Ae^{135k}}{Ae^{120k}}[/tex]

[tex]\implies 2=\dfrac{e^{135k}}{e^{120k}}[/tex]

[tex]\implies 2=e^{135k} \cdot e^{-120k}[/tex]

[tex]\implies 2=e^{15k}[/tex]

[tex]\implies \ln 2 = \ln e^{15k}[/tex]

[tex]\implies \ln 2 =15k \ln e[/tex]

[tex]\implies \ln 2 =15k[/tex]

[tex]\implies k=\dfrac{1}{15}\ln 2[/tex]

Substitute t = 120, y = 90000 and the found value of k into the formula and solve for A:

[tex]\implies 90000=Ae^{\left(120 \cdot \frac{1}{15}\ln 2\right)}[/tex]

[tex]\implies 90000=Ae^{\left(8\ln 2\right)}[/tex]

[tex]\implies 90000=Ae^{\ln256}[/tex]

[tex]\implies 90000=256A[/tex]

[tex]\implies A=\dfrac{90000}{256}[/tex]

[tex]\implies A=351.5625[/tex]

Therefore, the function that models the scenario is:

[tex]\large\boxed{y=351.5625e^{\left(\frac{1}{15}t \ln 2\right)}}[/tex]

So the initial population at time t = 0 was:

351.5625

To find the size of the bacteria population after 3 hours, substitute t = 180 into the found formula:

[tex]\implies y=351.5625e^{\left(\frac{1}{15}(180) \ln 2\right)}[/tex]

[tex]\implies y=351.5625e^{\left(12 \ln 2\right)}[/tex]

[tex]\implies y=351.5625e^{\left(\ln 4096\right)}[/tex]

[tex]\implies y=351.5625 \cdot 4096[/tex]

[tex]\implies y=1440000[/tex]

Therefore, the size of the bacterial population after 3 hours was:

1,440,000

The initial population at the time t = 0 is 351.5625. And the size of the bacterial population after 3 hours is 1,440,000.

What is Exponential Growth?

An exponential function's curve is created by a pattern of data called exponential growth, which exhibits higher increases over time.

If n₀ is the initial size of a population experiencing exponential growth, then the population n(t) at time t is modeled by the function:

n(t) = n₀(e[tex])^{rt}[/tex]

Where r is the relative rate of growth expressed as a fraction of the population.

Given:

Doubling period = 15 minutes

At t = 120 minutes, n(t) = 90,000

If the doubling period is 15 minutes, then at t = 120+15 = 135 minutes,

90000 = n₀(e[tex])^{120r}[/tex]

18000 =  n₀(e[tex])^{135r}[/tex]]

To find the r:

Take ratio of both of the equations,

90000 / 18000 = n₀(e[tex])^{120r}[/tex]  /   n₀(e[tex])^{135r}[/tex]

2 = (e[tex])^{135r}[/tex] . (e[tex])^{-120r}[/tex]

r = 1/15 ln2

Substitute the value of r, t and y.

90000 = n₀(e[tex])^{120r}[/tex]

90000 = 256n₀

n₀ = 351.5652

Now, the function

n(t) = n₀(e[tex])^{rt}[/tex]

n(t) = (351.5652)(e[tex])^{(1/15)(180)(ln2)}[/tex]

n(t) = 1440000

Therefore, the initial population at the time t = 0 is 351.5625. And the size of the bacterial population after 3 hours is 1,440,000.

To learn more about the exponential growth;

https://brainly.com/question/12490064

#SPJ1


Camilla wants to attach a string of lights to the edges of her patio
for a party She does not want the string to go across the edge with
the steps. White a linear expression that represents the length of
string in feet she will need. Then find the length if x = 3. 7.EE1
4x-2
3r

Answers

The length of string in feet she will need for her patio is equal to : L{s} = 2(x + y).

What is a mathematical function, equation and expression?   function : In mathematics, a function from a set X to a set Y assigns to each element of X exactly one element of Y. The set X is called the domain of the function and the set Y is called the codomain of the function.expression : A mathematical expression is made up of terms (constants and variables) separated by mathematical operators.equation : A mathematical equation is used to equate two expressions.

Given is Camilla who wants to attach a string of lights to the edges of her patio for a party. She does not want the string to go across the edge with the steps.

Assume the shape of the patio is a rectangle with the dimensions of [x] and [y] units long. The length of string in feet she will need will be equivalent to the perimeter of the rectangle. So, the length of string in feet she will need is equal to L{s} = 2(x + y).

Therefore, the length of string in feet she will need for her patio is equal to : L{s} = 2(x + y).

To solve more questions on functions, expressions and polynomials, visit the link below -

brainly.com/question/17421223

#SPJ1

Other Questions
How did the Civil Rights movement achievegains between 1955 and 1965? In June 1876, under orders from the US government to force the Native Americans onto reservations, federal troops entered the Little Bighorn Valley in Montana Territory. Although the troops were outnumbered, they attacked anyway. This battle is known as NO LINKS PLEASE At what speed do a bicycle and its rider, with a combined mass of 90 kgkg , have the same momentum as a 1500 kgkg car traveling at 4.0 m/sm/s ? Which imaging technologies do not use radiation? What is the value of this expression 6 + 24 +3.0.5(42) Which level of organization is this? HELP PLEASE I WILL MAKE YOU BRAIN LIST I NEED THE ANSWER TODAY What happened to Germany after WW2 which symbolized the Cold War era? A. Hitler was forced to sign the Treaty of Versailles and accept all blame.B. It was divided into East & West zones of influence by the US, Great Britain, France and USSRC. Hitler surrendered himself to Soviet Leader Joseph Stalin in exchange for lighter punishment on GermanyD. Germany was wiped off the map completely and rebuilt with the Berlin WallThe 2.Butter Battle was a metaphor for the arms race between USSR & USA. Why do the Zooks and Yooks threaten but refrain from dropping "Big-Boy Boomeroo"?A. Both sides are waiting for the other to drop it so they can blame the other side for the warB. The Yooks and Zooks respect the Berlin Curtain between their two sidesC. Nuclear Weapons threaten mutually assured destruction between the two sidesD. This story is not a metaphor for the Cold War but is about Hitlers' Invasion of Poland3*** BONUS*** The US ignored criminal charges against Nazis and recruited them in the science and engineering fields as a part of what?A. Berlin Airlift ProjectB. Project OverlordC. Radium Girl ExperimentationD. Operation Paperclip What are the 5 tribes of the Iroquois Confederacy? In the carbon cycle, several processes contribute to the movement of carbon through the ecosystem. For each of the types of movement below, name the process in the carbon cycle that accomplishes it: A. Movement of carbon from the atmosphere into living organisms: ___________________ B. Movement of carbon from living organisms into the atmosphere: ___________________ C. Movement of carbon between different organisms due to feeding: ____________________ PLEASE HELP HELP HELP HELP WILL MAKE BRAINLIEST write the slope intercept form of the equation of each line whats the absolute value of 23 Explain how gene therapy is able to solve genetic diseases. Please takeyour time explaining in detail a few of the the tools that are currently usedfor this treatment. (5 marks) PLEASE HELP IF YOU SEE THIS !!!!!DONT COMMENT IF YOU DONT HAVE THE ANSWER I REALLY NEED HELP ON THIS THANK YOU!!!! How do you think inclusion and diversity applies to everyday life? (150-200 words) Find the distance between the points (2, 4) and (8,-8) on a coordinate plane, to the nearest whole number. For the function g(x) = 10 VX-2, what is the inverse function?o pr}(X) = 7+2O q'(x) = -2O 0760) = (+)+2O 011(x) = (+) -- Essay questions may also be referred to asa. Talk questionsb. Explain questionsC.Hard questionsThink questionsd.Please select the best answer from the choices providedABD PLEASE HELPA submarine is located at the sea level. If the submarine dives at the rate of 5 meters per 15 minutes, what will be the position of the submarine be with respect to sea level? 377?.378f5885246799448855