Which of the following correctly shows the flow of energy in a food chain

Answers

Answer 1

The direction of energy flow in simple food chain is always sun=> plants( producers)=> primary consumers=> secondary consumers=> tertiary consumers, than finally after death of an organism, to decomposers

Answer 2

The direction of energy flow in simple food chain is always sun=> plants( producers)=> primary consumers=> secondary consumers=> tertiary consumers.

What is food chain?

The sequence of events within an ecosystem known as a "food chain" occurs when one live organism eats a different organism, which is then eaten by a larger organism. A food chain is created by the transfer of energy as well as nutrients from one creature to another at various trophic levels. A food web is comprised of numerous linked food chains.

The feeding habits or connections between living things are also explained by the food chain. Trophic level is the term used to describe the orderly phases in a food chain, from producers from the bottom through primary, secondary, and tertiary consumers. A trophic level is any position along a food chain.  A food web and a food chain are similar, but a food web seems far bigger. The direction of energy flow in simple food chain is always sun=> plants( producers)=> primary consumers=> secondary consumers=> tertiary consumers.

Therefore, the direction of energy flow in simple food chain is always sun=> plants( producers)=> primary consumers=> secondary consumers=> tertiary consumers.

To know more about food chain, here:

https://brainly.com/question/17172730

#SPJ3


Related Questions

HELPP ME

express with equations the transformations marked on the scheme

Answers

Further explanation

The reaction equation is the chemical formula of reagents and product substances

A reaction coefficient is a number in the chemical formula of a substance involved in the reaction equation. The reaction coefficient is useful for equalizing reagents and products.

Transformations :

1. CaO + H₂O⇒Ca(OH)₂

2. CaO + CO₂⇒CaCO₃

3. Ca(OH)₂+ 2HCl⇒CaCl₂+2H₂O

4. Ca(OH)₂+H₂CO₃⇒CaCO₃+2H₂O

5. CaCO₃⇒CaO+CO₂

Please help me with my Chemistry homework!! I have so much homework to do for other classes and I’m so stressed so even answering one question would be amazing!!!

1. A graduated cylinder had an initial volume of water of 22 mL. After an iron nail is dropped into the cylinder, the water rises to 38 mL. What is the volume of the nail?

2. Ms.Chavez dropped a gold ring into a graduated cylinder filled with water. The water level was originally at 20 mL. Now the water is at 25mL. Ms.Chavez knows that means the volume of the ring is 5 mL. What else would she have to do to find the density of her ring? Explain.

3. A simple of liquid propanol has a volume of 20.0 cm*^3 and a mass of 15.0 g. What is the density of propanol? Write only your answer below.

Answers

1. 16 mL

2. She need to find the mass, as density is mass divided by volume.

3. 0.75 g/cm^3

The diagram is a model of one way that materials move into a cell.


Which Sentence explains what happens in last step?

A. a vacuole carries particles into the cell
B. The cell membrane surrounds particles outside the cell.
C. Phospholipids in the cell membrane allow particles to pass through
D. Transport proteins push particles out of cell.

Answers

Answer:

B. The cell membrane surrounds particles outside the cell.

Explanation:

The last step is when the cell membrane completely surrounds particles outside the cell.

This process is often known as endocytosis.

endocytosis is the process whereby a cell ingests materials by engulfing them using the cell membrane. In this process, the cell membrane completely covers the food.

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.

Answers

Answer:D) it is used as an insulator

Explanation:

the process that breaks down rocks

Answers

Weathering is the breaking down or dissolving of rocks and minerals on earths surface!

An unbalanced chemical equation is shown:

2NaN3 → 2Na + N2

Which of the following statements explains why the equation is not balanced?

Four molecules of N2 should be produced during the decomposition.
Three molecules of N2 should be produced during the decomposition.
Four molecules of N2 should be produced during the synthesis reaction.
Three molecules of N2 should be produced during the synthesis reaction.

Answers

The correct statement is B. Three molecules of N₂ should be produced during the decomposition. :)

Answer: b

Explanation: I took the quiz

How many moles of hydrogen
are in 3.7 moles of C8H11 NO2?

Answers

40.7 because I know

_________feedback is a type of feedback in which a system is triggered to produce an output.

Answers

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.





Explanation:

Have a great rest of your day
#TheWizzer

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity

Answers

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618

The average speeds of gas molecules in cylinders A, B, C, and D are 0.001 m/s, 0.05 m/s, 0.1 m/s, and 0.5 m/s respectively. Which cylinder contains gas that is closest to absolute zero?​

Answers

Answer:

cylindar a

Explanation:

I took the test

Answer:

A

Explanation:

PLZ ANSWER! MULTIPLE CHOICE!! MUST BE CORRECT!! I CANNOT GET THIS WRONG.

Answers

The answer is B, the second choice

Why is our mindset more important when you try to learn remotely than when you are learning face to face?

Answers

Answer:

It is more important because of the freedom.

Explanation:

While at home you can do your work of course... but you could lay down, take a nap. You could get on the game, play around. You could draw, and fiddle and dance and do WHATEVER you want with no teacher to stop you so you have to be your own motivation. You have to be your own teacher or its VERY easy to fail.

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

a gas tank is under 1 atm pressure at room temperature. if the temperature halved,what will happen to the pressure ​

Answers

Answer:

The pressure will also be halved.

Explanation:

Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.

What is arcade in south Center

Answers

Answer: game stop and mind games

Explanation:

i live near there

Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.

Answers

Answer:

Q = 4019.4 J

Explanation:

Given data:

Mass of ice = 20.0 g

Initial temperature = -10°C

Final temperature = 89.0°C

Amount of heat required = ?

Solution:

specific heat capacity of ice is 2.03 J/g.°C

Formula:

Q = m.c. ΔT

Q = amount of heat absorbed or released

m = mass of given substance

c = specific heat capacity of substance

ΔT = change in temperature

ΔT = T2 - T1

ΔT =  89.0°C - (-10°C)

ΔT = 99°C

Q = 20.0 g ×2.03 J/g.°C × 99°C

Q = 4019.4 J

Arrange the elements in order of increasing ionization energy. Use the
periodic table to identify their positions on the table.
Drag each tile to the correct box.
Hola
Tiles
chlorine
fluorine
gallium
phosphorus
Sequence

Answers

Answer:

Gallium - Phosphorous - Fluorine - Chlorine

Explanation:

Answer:

Gallium < Phosphorus < Chlorine < Fluorine

Explanation:

<3

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

How many molecules of CO2 are contained in 4.40g of CO2

Answers

Answer:

6.02 x 10²²molecules

Explanation:

Given parameters:

Mass of CO₂  = 4.4g

Unknown:

Number of molecules in CO₂  = ?

Solution:

To find the number of molecules in the given mass, we have to find the number of moles in the compound first;

   Number of moles  = [tex]\frac{mass}{molar mass}[/tex]  

Molar mass of CO₂  = 12 + 2(16) = 44g/mol

Insert the parameters and solve;

   Number of moles  = [tex]\frac{4.4g}{44g/mol}[/tex]   =  0.1mol

  1 mole of a substance contains 6.02 x 10²³molecules

  0.1 mole of CO₂ will contain 0.1 x 6.02 x 10²³molecules

                                                 = 6.02 x 10²²molecules

What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?

Answers

Answer:

3.1atm

Explanation:

Given parameters:

Volume of gas = 2L

Number of moles  = 0.25mol

Temperature  = 25°C = 25 + 273  = 298K

Unknown:

Pressure of the gas = ?

Solution:

To solve this problem, we use the ideal gas equation.

This is given as;

       PV  = nRT

P is the pressure

V is the volume

n is the number of moles

R is the gas  constant  = 0.082atmdm³mol⁻¹K⁻¹

T is the temperature

          P  = [tex]\frac{nRT}{V}[/tex]  

 Now insert the parameters and solve;

         P  = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex]   = 3.1atm

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

Which is the molecular shape of water, H20, according to the VSEPR theory?
A. Bent
B. Tetrahedral
C. trigonal pyramidal
D. Trigonal planar

Answers

Answer:

the answer is A

Explanation:

Which best describes why NH4+ can form an ionic bond with CF?

Its outermost shell gains one or more electrons from CF.

Its positive charge is attracted to the negative charge of Cr.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cr.

Answers

Answer:

Its positive charge is attracted to the negative charge of Cl-

Note: The correct question is given below:

Which best describes why NH4+ can form an ionic bond with Cl-?

Its outermost shell gains one or more electrons from Cl-.

Its positive charge is attracted to the negative charge of Cl-.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cl-.

Its positive charge is attracted to the negative charge of Cl-.

Explanation:

An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.

An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.

Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.

Which container has gas stored at the highest temperature

Answers

Answer: 3

Explanation:

Answer:

kinetic energy

Explanation:

may be iam not sure

SECOND SCIENCE WORKSHEET:
Answer the following:
1:
Which type of cell has a cell wall?
2: What is the smallest part of any substance?
3:
What is used to see tiny objects?
4: What name is given to a substance where all the atoms are the
same?
5: What does the safety symbol with flames mean?
6: What gives the ability to do work?
7: Which part of the cell controls all cell activity?
8: By what process does a liquid change to a gas?
I

Answers

Answer:

1 animal cell

2?

3 mircoscope

4?

5 it means whenever you becareful

Use the equation below to solve the problem that follows.

2H2 (g) + O2 (g) → 2H2O (g)

When David reacts 13.8 grams of hydrogen gas with excess oxygen, 87.0 grams of water are formed. Calculate his percent yield of water.

Answers

Percent yield = 70%

Further eplanation

Percent yield is the comparison of the amount of product obtained from a reaction with the amount you calculated

General formula:

Percent yield = (Actual yield / theoretical yield )x 100%

An actual yield is the amount of product actually produced by the reaction. A theoretical yield is the amount of product that you calculate from the reaction equation according to the product and reactant coefficients

Reaction

2H₂ (g) + O₂ (g) → 2H₂O (g)

mass of H₂O (theoretical) :

[tex]\tt mass=mol\times MW(mol~ratio~H_2O\div H_2=2\div 2)\\\\mass=(\dfrac{2}{2}\times \dfrac{13.8}{2})\times 18~g/mol\\\\mass=124.2~g[/tex]

percent yield

[tex]\tt \%yield=\dfrac{87}{124.2}\times 100\%=\boxed{\bold{70\%}}[/tex]

Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.

Inductive Reasoning
Deductive Reasoning

Answers

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

Calculate the gravitational force between two objects when they are 0.75m apart each object has a mass of 5.00kg

Answers

Answer:

0.000000000666863

Explanation:

F = GMm/R²

Other Questions
Find f (h(-5)) f (x) 9x - 5 g(x) - 3x h(x) 2x2 Your answer: Give the slope between the points(-2,3) (-5, -9) i need help with a question! im going to post it now! some one please help!!!!its math The data below shows the duration of eruption (in seconds) of a geyser in a national park and the height (in feet) of the eruptions for a typical day. Use Excel to find the best fit linear regression equation, where duration of eruption is the explanatory variable. Round the slope and intercept to one decimal place.Duration Height240 140237 154122 140267 140113 160258 140232 150105 150186 160248 155243 125241 136214 140114 155272 130227 125237 125238 139203 125270 140218 140226 135250 141245 140120 139267 110103 140270 135241 140239 135Provide your answer below:y = _x + _ Which term best describes the materials that make up rocks?sand left by erosioncompressed magmaa mixture of mineralslayers of lava 4. A map has a scale of 1 inch = 100 miles. The distance between two cities is 7.25 inches. If a car travels50 miles per hour, about how long will it take to get from one city to another?hours Do the states that have the highest ad lowest have anything in common? the highest states is New Jersey , New York , Virgina the lowest states are Maryland , Massachusetts , Maine 1. why and how was rome able to conquer such a vast empire? what practice and institutions jobs facilitated this this?2. why and how did the roman empire fall? what circumstances facilitated this event? A shop sell bagels for 5$ per dozen Find y if 3 + 4y = 1 WILL GIVE BRAINLIEST!!!1Scientists released 6 rabbits into a new habitat in year 0. Each year, there were four times as many rabbits as the year before. How many rabbits were there after x years? Write a function to represent this scenario. f(x) = 6(x)^4f(x) = 6(4)^xf(x) = 4(6)^xf(x) = 4(x)^6 10(b)(ii). Faith wants to separate water and salt from a salt solution in abeaker. Choose the method shown in Diagram 10.1 which is suitable to beused. Explain. Penny, Inc. employs a process costing system. Direct materials are added at the beginning of the process. Here is information about Julys activities: On July 1: Beginning inventories 850 units, 60% complete Direct materials cost $5,000 Conversion costs $4,000 During July: Number of units started 15,000 Direct materials added $155,000 Conversion costs added $83,520 On July 31: Ending inventories 1,600 units, 40% complete Using the FIFO method and rounding cost per unit to four decimal places, the cost of goods completed and transferred out during July was:_________ Which of the following best describes an Arrhenius acid-base reaction? The amount of money spent weekly on cleaning, maintenance, and repairs at a large restaurant was observed over a long period of time to be approximately normally distributed, with mean = $633 and standard deviation = $45.Required:a. If $646 is budgeted for next week, what is the probability that the actual costs will exceed the budgeted amount?b. How much should be budgeted for weekly repairs, cleaning, and maintenance so that the probability that the budgeted amount will be exceeded in a given week is only 0.16? (Round your answer to the nearest dollar.) - 648-99how to solve it Kayla likes to mic 6 cups of water to 1 cup of lemonade. How much lemonade mix would she need if she uses a gallon of water? For Angela's English project, she wanted to be to the point in her presentation. She did not want to say more than she needed to because her project explained it all.answers: A. angela does not want others to touch her project.B. angela wants to touch the project with her finger. C. Angela wants her presentation to be very sharp.D. Angela wants to be very brief with what she says. write a conclusion paragraph for an essay on sleep. im in honores, and i need this to sound as profesional as possiblee ty! also this doesnt have to be that long! if you could give me at least three sentences that would be great ! a car is traveling at 30 metres per second it accelerates steadily for 5 seconds after which it is travelling at 50 metres per second calculate its acceleration